C22H23N3O5 — CID 46657706
3-(1,3-benzodioxol-5-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]propanamide (PubChem CID 46657706) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 46657706 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]propanamide |
| SMILES | CC1(CCc2ccccc2)NC(=O)N(NC(=O)CCc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C22H23N3O5/c1-22(12-11-15-5-3-2-4-6-15)20(27)25(21(28)23-22)24-19(26)10-8-16-7-9-17-18(13-16)30-14-29-17/h2-7,9,13H,8,10-12,14H2,1H3,(H,23,28)(H,24,26) |
| InChIKey | LGPYQXSLWJPODQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|