C24H26N4O3 — CID 55438287
4-(1H-indol-3-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]butanamide (PubChem CID 55438287) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 55438287 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]butanamide |
| SMILES | CC1(CCc2ccccc2)NC(=O)N(NC(=O)CCCc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C24H26N4O3/c1-24(15-14-17-8-3-2-4-9-17)22(30)28(23(31)26-24)27-21(29)13-7-10-18-16-25-20-12-6-5-11-19(18)20/h2-6,8-9,11-12,16,25H,7,10,13-15H2,1H3,(H,26,31)(H,27,29) |
| InChIKey | RDEZEPOGRRVEBK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|