C26H28N4O3 — CID 25498107
N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide (PubChem CID 25498107) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide.
| Compound Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide |
|---|---|
| PubChem CID | 25498107 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide |
| SMILES | C[C@H](NCC(=O)NN1C(=O)N[C@@](C)(CCc2ccccc2)C1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H28N4O3/c1-18(21-14-8-12-20-11-6-7-13-22(20)21)27-17-23(31)29-30-24(32)26(2,28-25(30)33)16-15-19-9-4-3-5-10-19/h3-14,18,27H,15-17H2,1-2H3,(H,28,33)(H,29,31)/t18-,26-/m0/s1 |
| InChIKey | OQHPSRZVKNNESK-QYBDOPJKSA-N |
| XLogP | 3.46 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|