C20H19N5O3 — CID 31438081
N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indazole-3-carboxamide (PubChem CID 31438081) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 31438081 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indazole-3-carboxamide |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(NC(=O)c2n[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C20H19N5O3/c1-20(12-11-13-7-3-2-4-8-13)18(27)25(19(28)21-20)24-17(26)16-14-9-5-6-10-15(14)22-23-16/h2-10H,11-12H2,1H3,(H,21,28)(H,22,23)(H,24,26)/t20-/m1/s1 |
| InChIKey | INBFSUDYCOVPCF-HXUWFJFHSA-N |
| XLogP | 2.15 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|