C27H23N5O4 — CID 41251194
N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-oxo-3-phenylphthalazine-1-carboxamide (PubChem CID 41251194) has the molecular formula C27H23N5O4 and a molecular weight of 481.51 g/mol. Its IUPAC name is N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-oxo-3-phenylphthalazine-1-carboxamide.
| Compound Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-oxo-3-phenylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 41251194 |
| Molecular Formula | C27H23N5O4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-oxo-3-phenylphthalazine-1-carboxamide |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(NC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)C1=O |
| InChI | InChI=1S/C27H23N5O4/c1-27(17-16-18-10-4-2-5-11-18)25(35)32(26(36)28-27)30-23(33)22-20-14-8-9-15-21(20)24(34)31(29-22)19-12-6-3-7-13-19/h2-15H,16-17H2,1H3,(H,28,36)(H,30,33)/t27-/m1/s1 |
| InChIKey | VGDOZTYEUKYCIW-HHHXNRCGSA-N |
| XLogP | 2.97 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|