C22H22N6O3 — CID 42920191
5-methyl-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-phenyltriazole-4-carboxamide (PubChem CID 42920191) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 5-methyl-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-phenyltriazole-4-carboxamide.
| Compound Name | 5-methyl-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 42920191 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 5-methyl-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)NN1C(=O)NC(C)(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H22N6O3/c1-15-18(25-28(24-15)17-11-7-4-8-12-17)19(29)26-27-20(30)22(2,23-21(27)31)14-13-16-9-5-3-6-10-16/h3-12H,13-14H2,1-2H3,(H,23,31)(H,26,29) |
| InChIKey | AABVYXCXNPCDHJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|