C29H32N2O6 — CID 53383587
methyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(benzylamino)-2-oxoethyl]-2-oxo-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate (PubChem CID 53383587) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is methyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(benzylamino)-2-oxoethyl]-2-oxo-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate.
| Compound Name | methyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(benzylamino)-2-oxoethyl]-2-oxo-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 53383587 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | methyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(benzylamino)-2-oxoethyl]-2-oxo-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCCCC=C1N(Cc1ccc3c(c1)OCO3)C(=O)[C@H](CC(=O)NCc1ccccc1)C2 |
| InChI | InChI=1S/C29H32N2O6/c1-35-28(34)29-13-7-3-6-10-25(29)31(18-21-11-12-23-24(14-21)37-19-36-23)27(33)22(16-29)15-26(32)30-17-20-8-4-2-5-9-20/h2,4-5,8-12,14,22H,3,6-7,13,15-19H2,1H3,(H,30,32)/t22-,29+/m1/s1 |
| InChIKey | MKWXUXLVSBHRPK-MNNSJKJDSA-N |
| XLogP | 4.09 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |