C29H40N2O7 — CID 53299957
ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate (PubChem CID 53299957) has the molecular formula C29H40N2O7 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate.
| Compound Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53299957 |
| Molecular Formula | C29H40N2O7 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
| SMILES | CCCCOCCCNC(=O)C[C@@H]1C[C@@]2(C(=O)OCC)CCCC=C2N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C29H40N2O7/c1-3-5-14-35-15-8-13-30-26(32)17-22-18-29(28(34)36-4-2)12-7-6-9-25(29)31(27(22)33)19-21-10-11-23-24(16-21)38-20-37-23/h9-11,16,22H,3-8,12-15,17-20H2,1-2H3,(H,30,32)/t22-,29+/m1/s1 |
| InChIKey | PQKABJFRCXCBKX-MNNSJKJDSA-N |
| XLogP | 4.09 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|