C28H35N3O7 — CID 53300044
ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate (PubChem CID 53300044) has the molecular formula C28H35N3O7 and a molecular weight of 525.60 g/mol. Its IUPAC name is ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate.
| Compound Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 53300044 |
| Molecular Formula | C28H35N3O7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)propylamino]ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC=C1N(Cc1ccc3c(c1)OCO3)C(=O)[C@H](CC(=O)NCCCN1CCCC1=O)C2 |
| InChI | InChI=1S/C28H35N3O7/c1-2-36-27(35)28-10-3-6-23(28)31(17-19-8-9-21-22(14-19)38-18-37-21)26(34)20(16-28)15-24(32)29-11-5-13-30-12-4-7-25(30)33/h6,8-9,14,20H,2-5,7,10-13,15-18H2,1H3,(H,29,32)/t20-,28+/m1/s1 |
| InChIKey | BXJKVBJWRXCMFE-NGOKVRLYSA-N |
| XLogP | 2.51 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|