C30H31F3N2O6 — CID 53299946
ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate (PubChem CID 53299946) has the molecular formula C30H31F3N2O6 and a molecular weight of 572.58 g/mol. Its IUPAC name is ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate.
| Compound Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53299946 |
| Molecular Formula | C30H31F3N2O6 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-2-oxo-3-[2-oxo-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCC=C1N(Cc1ccc3c(c1)OCO3)C(=O)[C@H](CC(=O)NCc1cccc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C30H31F3N2O6/c1-2-39-28(38)29-11-4-3-8-25(29)35(17-20-9-10-23-24(13-20)41-18-40-23)27(37)21(15-29)14-26(36)34-16-19-6-5-7-22(12-19)30(31,32)33/h5-10,12-13,21H,2-4,11,14-18H2,1H3,(H,34,36)/t21-,29+/m1/s1 |
| InChIKey | AVTNIJCHMFDYND-PBBNMVCDSA-N |
| XLogP | 5.11 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |