C34H36N2O6 — CID 53383938
methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-6,6-dimethyl-3-[2-(naphthalen-1-ylmethylamino)-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53383938) has the molecular formula C34H36N2O6 and a molecular weight of 568.67 g/mol. Its IUPAC name is methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-6,6-dimethyl-3-[2-(naphthalen-1-ylmethylamino)-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-6,6-dimethyl-3-[2-(naphthalen-1-ylmethylamino)-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53383938 |
| Molecular Formula | C34H36N2O6 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-6,6-dimethyl-3-[2-(naphthalen-1-ylmethylamino)-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](CC(=O)NCc3cccc4ccccc34)C(=O)N(Cc3ccc4c(c3)OCO4)C1=CCC(C)(C)C2 |
| InChI | InChI=1S/C34H36N2O6/c1-33(2)14-13-29-34(20-33,32(39)40-3)17-25(31(38)36(29)19-22-11-12-27-28(15-22)42-21-41-27)16-30(37)35-18-24-9-6-8-23-7-4-5-10-26(23)24/h4-13,15,25H,14,16-21H2,1-3H3,(H,35,37)/t25-,34-/m1/s1 |
| InChIKey | FVXSQJKITVIEIY-QCBOHVIISA-N |
| XLogP | 5.49 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |