C30H42N2O7 — CID 53383952
methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53383952) has the molecular formula C30H42N2O7 and a molecular weight of 542.67 g/mol. Its IUPAC name is methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53383952 |
| Molecular Formula | C30H42N2O7 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | methyl (3S,4aR)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3-butoxypropylamino)-2-oxoethyl]-6,6-dimethyl-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | CCCCOCCCNC(=O)C[C@@H]1C[C@@]2(C(=O)OC)CC(C)(C)CC=C2N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C30H42N2O7/c1-5-6-13-37-14-7-12-31-26(33)16-22-17-30(28(35)36-4)19-29(2,3)11-10-25(30)32(27(22)34)18-21-8-9-23-24(15-21)39-20-38-23/h8-10,15,22H,5-7,11-14,16-20H2,1-4H3,(H,31,33)/t22-,30-/m1/s1 |
| InChIKey | GYAAAJCVTWIVQF-YKGWIAGDSA-N |
| XLogP | 4.34 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|