C28H32N2O7 — CID 53299956
ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate (PubChem CID 53299956) has the molecular formula C28H32N2O7 and a molecular weight of 508.57 g/mol. Its IUPAC name is ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate.
| Compound Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53299956 |
| Molecular Formula | C28H32N2O7 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | ethyl (3S,4aS)-1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-4,5,6,7-tetrahydro-3H-quinoline-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCC=C1N(Cc1ccc3c(c1)OCO3)C(=O)[C@H](CC(=O)NCc1ccc(C)o1)C2 |
| InChI | InChI=1S/C28H32N2O7/c1-3-34-27(33)28-11-5-4-6-24(28)30(16-19-8-10-22-23(12-19)36-17-35-22)26(32)20(14-28)13-25(31)29-15-21-9-7-18(2)37-21/h6-10,12,20H,3-5,11,13-17H2,1-2H3,(H,29,31)/t20-,28+/m1/s1 |
| InChIKey | ZKKQHPSYEFTWHT-NGOKVRLYSA-N |
| XLogP | 3.99 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |