C26H32N2O6 — CID 53384023
methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53384023) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53384023 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | methyl (3S,4aR)-1-(furan-2-ylmethyl)-6,6-dimethyl-3-[2-[(5-methylfuran-2-yl)methylamino]-2-oxoethyl]-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](CC(=O)NCc3ccc(C)o3)C(=O)N(Cc3ccco3)C1=CCC(C)(C)C2 |
| InChI | InChI=1S/C26H32N2O6/c1-17-7-8-19(34-17)14-27-22(29)12-18-13-26(24(31)32-4)16-25(2,3)10-9-21(26)28(23(18)30)15-20-6-5-11-33-20/h5-9,11,18H,10,12-16H2,1-4H3,(H,27,29)/t18-,26-/m1/s1 |
| InChIKey | ZHUDPTPVTOBOQA-WXTAPIANSA-N |
| XLogP | 4.10 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |