C31H40N2O4 — CID 53384032
methyl (3S,4aR)-6,6-dimethyl-3-[2-(3-methylbutylamino)-2-oxoethyl]-1-(naphthalen-1-ylmethyl)-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate (PubChem CID 53384032) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is methyl (3S,4aR)-6,6-dimethyl-3-[2-(3-methylbutylamino)-2-oxoethyl]-1-(naphthalen-1-ylmethyl)-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate.
| Compound Name | methyl (3S,4aR)-6,6-dimethyl-3-[2-(3-methylbutylamino)-2-oxoethyl]-1-(naphthalen-1-ylmethyl)-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 53384032 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | methyl (3S,4aR)-6,6-dimethyl-3-[2-(3-methylbutylamino)-2-oxoethyl]-1-(naphthalen-1-ylmethyl)-2-oxo-3,4,5,7-tetrahydroquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](CC(=O)NCCC(C)C)C(=O)N(Cc3cccc4ccccc34)C1=CCC(C)(C)C2 |
| InChI | InChI=1S/C31H40N2O4/c1-21(2)14-16-32-27(34)17-24-18-31(29(36)37-5)20-30(3,4)15-13-26(31)33(28(24)35)19-23-11-8-10-22-9-6-7-12-25(22)23/h6-13,21,24H,14-20H2,1-5H3,(H,32,34)/t24-,31-/m1/s1 |
| InChIKey | AZCZKSFDMOVPOU-WBBHLRKXSA-N |
| XLogP | 5.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |