C38H46N2O5 — CID 71499577
methyl (3R,4aS,5S,7S)-7-tert-butyl-5-methyl-1-(naphthalen-1-ylmethyl)-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate (PubChem CID 71499577) has the molecular formula C38H46N2O5 and a molecular weight of 610.80 g/mol. Its IUPAC name is methyl (3R,4aS,5S,7S)-7-tert-butyl-5-methyl-1-(naphthalen-1-ylmethyl)-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate.
| Compound Name | methyl (3R,4aS,5S,7S)-7-tert-butyl-5-methyl-1-(naphthalen-1-ylmethyl)-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 71499577 |
| Molecular Formula | C38H46N2O5 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | methyl (3R,4aS,5S,7S)-7-tert-butyl-5-methyl-1-(naphthalen-1-ylmethyl)-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@H](CC(=O)NCCCCc3ccccc3)C(=O)N(Cc3cccc4ccccc34)C1=C[C@@H](C(C)(C)C)O[C@H]2C |
| InChI | InChI=1S/C38H46N2O5/c1-26-38(36(43)44-5)24-30(22-34(41)39-21-12-11-16-27-14-7-6-8-15-27)35(42)40(32(38)23-33(45-26)37(2,3)4)25-29-19-13-18-28-17-9-10-20-31(28)29/h6-10,13-15,17-20,23,26,30,33H,11-12,16,21-22,24-25H2,1-5H3,(H,39,41)/t26-,30-,33-,38+/m0/s1 |
| InChIKey | NBIIIYMOWCIKQY-BMGFZNDDSA-N |
| XLogP | 6.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|