C24H31NO6 — CID 71500970
2-[(3R,4aS,5S,7S)-1-benzyl-7-tert-butyl-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid (PubChem CID 71500970) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-[(3R,4aS,5S,7S)-1-benzyl-7-tert-butyl-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4aS,5S,7S)-1-benzyl-7-tert-butyl-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 71500970 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[(3R,4aS,5S,7S)-1-benzyl-7-tert-butyl-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid |
| SMILES | COC(=O)[C@@]12C[C@H](CC(=O)O)C(=O)N(Cc3ccccc3)C1=C[C@@H](C(C)(C)C)O[C@H]2C |
| InChI | InChI=1S/C24H31NO6/c1-15-24(22(29)30-5)13-17(11-20(26)27)21(28)25(14-16-9-7-6-8-10-16)18(24)12-19(31-15)23(2,3)4/h6-10,12,15,17,19H,11,13-14H2,1-5H3,(H,26,27)/t15-,17-,19-,24+/m0/s1 |
| InChIKey | NNUBMRKAYZFIFI-UJNGOAIISA-N |
| XLogP | 3.39 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |