C33H46N2O6 — CID 56589254
methyl (3R,4aR,5R,7R)-3-[2-(butylamino)-2-oxoethyl]-1-[2-(cyclohexen-1-yl)ethyl]-5-methyl-2-oxo-7-(phenylmethoxymethyl)-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate (PubChem CID 56589254) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is methyl (3R,4aR,5R,7R)-3-[2-(butylamino)-2-oxoethyl]-1-[2-(cyclohexen-1-yl)ethyl]-5-methyl-2-oxo-7-(phenylmethoxymethyl)-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate.
| Compound Name | methyl (3R,4aR,5R,7R)-3-[2-(butylamino)-2-oxoethyl]-1-[2-(cyclohexen-1-yl)ethyl]-5-methyl-2-oxo-7-(phenylmethoxymethyl)-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 56589254 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | methyl (3R,4aR,5R,7R)-3-[2-(butylamino)-2-oxoethyl]-1-[2-(cyclohexen-1-yl)ethyl]-5-methyl-2-oxo-7-(phenylmethoxymethyl)-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
| SMILES | CCCCNC(=O)C[C@H]1C[C@@]2(C(=O)OC)C(=C[C@H](COCc3ccccc3)O[C@@H]2C)N(CCC2=CCCCC2)C1=O |
| InChI | InChI=1S/C33H46N2O6/c1-4-5-17-34-30(36)19-27-21-33(32(38)39-3)24(2)41-28(23-40-22-26-14-10-7-11-15-26)20-29(33)35(31(27)37)18-16-25-12-8-6-9-13-25/h7,10-12,14-15,20,24,27-28H,4-6,8-9,13,16-19,21-23H2,1-3H3,(H,34,36)/t24-,27+,28-,33+/m1/s1 |
| InChIKey | BRPVTSIIFXPWSH-FABYRPBCSA-N |
| XLogP | 5.08 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|