C31H42N2O5S — CID 71500647
methyl (3R,4aS,5S,7R)-1-[2-(cyclohexen-1-yl)ethyl]-5-cyclopropyl-2-oxo-3-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-7-propan-2-yl-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate (PubChem CID 71500647) has the molecular formula C31H42N2O5S and a molecular weight of 554.75 g/mol. Its IUPAC name is methyl (3R,4aS,5S,7R)-1-[2-(cyclohexen-1-yl)ethyl]-5-cyclopropyl-2-oxo-3-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-7-propan-2-yl-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate.
| Compound Name | methyl (3R,4aS,5S,7R)-1-[2-(cyclohexen-1-yl)ethyl]-5-cyclopropyl-2-oxo-3-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-7-propan-2-yl-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 71500647 |
| Molecular Formula | C31H42N2O5S |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | methyl (3R,4aS,5S,7R)-1-[2-(cyclohexen-1-yl)ethyl]-5-cyclopropyl-2-oxo-3-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]-7-propan-2-yl-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@H](CC(=O)NCc3cccs3)C(=O)N(CCC3=CCCCC3)C1=C[C@@H](C(C)C)O[C@H]2C1CC1 |
| InChI | InChI=1S/C31H42N2O5S/c1-20(2)25-17-26-31(30(36)37-3,28(38-25)22-11-12-22)18-23(16-27(34)32-19-24-10-7-15-39-24)29(35)33(26)14-13-21-8-5-4-6-9-21/h7-8,10,15,17,20,22-23,25,28H,4-6,9,11-14,16,18-19H2,1-3H3,(H,32,34)/t23-,25-,28-,31-/m0/s1 |
| InChIKey | IRQKRIBUOVEXLI-QQHIAEJKSA-N |
| XLogP | 5.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|