C34H48N2O6 — CID 56589234
methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate (PubChem CID 56589234) has the molecular formula C34H48N2O6 and a molecular weight of 580.77 g/mol. Its IUPAC name is methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate.
| Compound Name | methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 56589234 |
| Molecular Formula | C34H48N2O6 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-3-[2-[2-(2-methoxyphenyl)ethylamino]-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
| SMILES | COC(=O)[C@]12C[C@H](CC(=O)NCCc3ccccc3OC)C(=O)N(CCC3=CCCCC3)C1=C[C@H](C(C)(C)C)O[C@@H]2C |
| InChI | InChI=1S/C34H48N2O6/c1-23-34(32(39)41-6)22-26(20-30(37)35-18-16-25-14-10-11-15-27(25)40-5)31(38)36(19-17-24-12-8-7-9-13-24)28(34)21-29(42-23)33(2,3)4/h10-12,14-15,21,23,26,29H,7-9,13,16-20,22H2,1-6H3,(H,35,37)/t23-,26+,29-,34+/m1/s1 |
| InChIKey | YGAZUGSMKNNKRN-PQMMARCSSA-N |
| XLogP | 5.36 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|