C22H26N2O5 — CID 53301108
methyl (3S,4aS)-1-(furan-2-ylmethyl)-2-oxo-3-[2-oxo-2-(prop-2-ynylamino)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate (PubChem CID 53301108) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl (3S,4aS)-1-(furan-2-ylmethyl)-2-oxo-3-[2-oxo-2-(prop-2-ynylamino)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate.
| Compound Name | methyl (3S,4aS)-1-(furan-2-ylmethyl)-2-oxo-3-[2-oxo-2-(prop-2-ynylamino)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 53301108 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | methyl (3S,4aS)-1-(furan-2-ylmethyl)-2-oxo-3-[2-oxo-2-(prop-2-ynylamino)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
| SMILES | C#CCNC(=O)C[C@@H]1C[C@@]2(C(=O)OC)CCCCC=C2N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C22H26N2O5/c1-3-11-23-19(25)13-16-14-22(21(27)28-2)10-6-4-5-9-18(22)24(20(16)26)15-17-8-7-12-29-17/h1,7-9,12,16H,4-6,10-11,13-15H2,2H3,(H,23,25)/t16-,22+/m1/s1 |
| InChIKey | BNHFJVUMTVVPNX-ZHRRBRCNSA-N |
| XLogP | 2.38 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|