C33H42N2O6 — CID 71502020
ethyl (3R,4aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate (PubChem CID 71502020) has the molecular formula C33H42N2O6 and a molecular weight of 562.71 g/mol. Its IUPAC name is ethyl (3R,4aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate.
| Compound Name | ethyl (3R,4aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 71502020 |
| Molecular Formula | C33H42N2O6 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | ethyl (3R,4aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3-[2-oxo-2-(4-phenylbutylamino)ethyl]-3,4,5,6-tetrahydrocyclopenta[b]pyridine-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC=C1N(CCc1ccc(OC)c(OC)c1)C(=O)[C@@H](CC(=O)NCCCCc1ccccc1)C2 |
| InChI | InChI=1S/C33H42N2O6/c1-4-41-32(38)33-18-10-14-29(33)35(20-17-25-15-16-27(39-2)28(21-25)40-3)31(37)26(23-33)22-30(36)34-19-9-8-13-24-11-6-5-7-12-24/h5-7,11-12,14-16,21,26H,4,8-10,13,17-20,22-23H2,1-3H3,(H,34,36)/t26-,33-/m0/s1 |
| InChIKey | XLAZFJMNMFSDJG-UBOZLPQGSA-N |
| XLogP | 4.85 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|