C31H46N2O8 — CID 56589387
methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(3-methoxypropylamino)-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate (PubChem CID 56589387) has the molecular formula C31H46N2O8 and a molecular weight of 574.72 g/mol. Its IUPAC name is methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(3-methoxypropylamino)-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate.
| Compound Name | methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(3-methoxypropylamino)-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 56589387 |
| Molecular Formula | C31H46N2O8 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | methyl (3R,4aR,5R,7R)-7-tert-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2-(3-methoxypropylamino)-2-oxoethyl]-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridine-4a-carboxylate |
| SMILES | COCCCNC(=O)C[C@H]1C[C@@]2(C(=O)OC)C(=C[C@H](C(C)(C)C)O[C@@H]2C)N(CCc2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C31H46N2O8/c1-20-31(29(36)40-8)19-22(17-27(34)32-13-9-15-37-5)28(35)33(25(31)18-26(41-20)30(2,3)4)14-12-21-10-11-23(38-6)24(16-21)39-7/h10-11,16,18,20,22,26H,9,12-15,17,19H2,1-8H3,(H,32,34)/t20-,22+,26-,31+/m1/s1 |
| InChIKey | ZTLRUYGNMJKCBB-RSKXWFEESA-N |
| XLogP | 3.51 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|