C23H23NO5 — CID 100906380
methyl (1S,3R,6R,9R)-8-benzyl-6-methyl-4-oxo-9-phenyl-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate (PubChem CID 100906380) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl (1S,3R,6R,9R)-8-benzyl-6-methyl-4-oxo-9-phenyl-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate.
| Compound Name | methyl (1S,3R,6R,9R)-8-benzyl-6-methyl-4-oxo-9-phenyl-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
|---|---|
| PubChem CID | 100906380 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | methyl (1S,3R,6R,9R)-8-benzyl-6-methyl-4-oxo-9-phenyl-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
| SMILES | COC(=O)[C@]12O[C@]13C[C@H](c1ccccc1)N(Cc1ccccc1)C[C@@]3(C)OC2=O |
| InChI | InChI=1S/C23H23NO5/c1-21-15-24(14-16-9-5-3-6-10-16)18(17-11-7-4-8-12-17)13-22(21)23(29-22,19(25)27-2)20(26)28-21/h3-12,18H,13-15H2,1-2H3/t18-,21-,22+,23-/m1/s1 |
| InChIKey | DHGLVUTYAZQSJK-TWHAJKEOSA-N |
| XLogP | 2.63 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|