C19H23NO2 — CID 124835491
(3S,4R,6R)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol (PubChem CID 124835491) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (3S,4R,6R)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol.
| Compound Name | (3S,4R,6R)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 124835491 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (3S,4R,6R)-1-benzyl-3-methyl-6-phenylpiperidine-3,4-diol |
| SMILES | C[C@]1(O)CN(Cc2ccccc2)[C@@H](c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C19H23NO2/c1-19(22)14-20(13-15-8-4-2-5-9-15)17(12-18(19)21)16-10-6-3-7-11-16/h2-11,17-18,21-22H,12-14H2,1H3/t17-,18-,19+/m1/s1 |
| InChIKey | VAKBKORICCUVPK-QRVBRYPASA-N |
| XLogP | 2.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |