C12H17NO — CID 10774084
(2S,3S)-1-benzyl-2,3-dimethylazetidin-3-ol (PubChem CID 10774084) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2S,3S)-1-benzyl-2,3-dimethylazetidin-3-ol.
| Compound Name | (2S,3S)-1-benzyl-2,3-dimethylazetidin-3-ol |
|---|---|
| PubChem CID | 10774084 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2S,3S)-1-benzyl-2,3-dimethylazetidin-3-ol |
| SMILES | C[C@@H]1N(Cc2ccccc2)C[C@]1(C)O |
| InChI | InChI=1S/C12H17NO/c1-10-12(2,14)9-13(10)8-11-6-4-3-5-7-11/h3-7,10,14H,8-9H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | FNAZYZFPDZJJIN-JQWIXIFHSA-N |
| XLogP | 1.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |