C26H35N3O3S — CID 138398495
1-benzyl-3-(1-methylpyrrolidin-2-yl)indole;cyclohexylsulfamic acid (PubChem CID 138398495) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is 1-benzyl-3-(1-methylpyrrolidin-2-yl)indole;cyclohexylsulfamic acid.
| Compound Name | 1-benzyl-3-(1-methylpyrrolidin-2-yl)indole;cyclohexylsulfamic acid |
|---|---|
| PubChem CID | 138398495 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 1-benzyl-3-(1-methylpyrrolidin-2-yl)indole;cyclohexylsulfamic acid |
| SMILES | CN1CCCC1c1cn(Cc2ccccc2)c2ccccc12.O=S(=O)(O)NC1CCCCC1 |
| InChI | InChI=1S/C20H22N2.C6H13NO3S/c1-21-13-7-12-19(21)18-15-22(14-16-8-3-2-4-9-16)20-11-6-5-10-17(18)20;8-11(9,10)7-6-4-2-1-3-5-6/h2-6,8-11,15,19H,7,12-14H2,1H3;6-7H,1-5H2,(H,8,9,10) |
| InChIKey | ISPVXYGNERQUGG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|