C13H21NO3S — CID 174758648
1,2-dimethylpyrrolidine;phenylmethanesulfonic acid (PubChem CID 174758648) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 1,2-dimethylpyrrolidine;phenylmethanesulfonic acid.
| Compound Name | 1,2-dimethylpyrrolidine;phenylmethanesulfonic acid |
|---|---|
| PubChem CID | 174758648 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1,2-dimethylpyrrolidine;phenylmethanesulfonic acid |
| SMILES | CC1CCCN1C.O=S(=O)(O)Cc1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C6H13N/c8-11(9,10)6-7-4-2-1-3-5-7;1-6-4-3-5-7(6)2/h1-5H,6H2,(H,8,9,10);6H,3-5H2,1-2H3 |
| InChIKey | MELAXCUCKSOCEP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|