About benzyl formate;1-methyl-2-methylsulfonylpyrrolidine
benzyl formate;1-methyl-2-methylsulfonylpyrrolidine (PubChem CID 174511816) has the molecular formula C14H21NO4S
and a molecular weight of 299.39 g/mol. Its IUPAC name is benzyl formate;1-methyl-2-methylsulfonylpyrrolidine.
Molecular Properties
| Compound Name | benzyl formate;1-methyl-2-methylsulfonylpyrrolidine |
| PubChem CID | 174511816 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | benzyl formate;1-methyl-2-methylsulfonylpyrrolidine |
| SMILES | CN1CCCC1S(C)(=O)=O.O=COCc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C6H13NO2S/c9-7-10-6-8-4-2-1-3-5-8;1-7-5-3-4-6(7)10(2,8)9/h1-5,7H,6H2;6H,3-5H2,1-2H3 |
| InChIKey | XHAWUXQSDAOTHY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzyl formate;1-methyl-2-methylsulfonylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl formate;1-methyl-2-methylsulfonylpyrrolidine?
The IUPAC name of benzyl formate;1-methyl-2-methylsulfonylpyrrolidine (CID 174511816) is benzyl formate;1-methyl-2-methylsulfonylpyrrolidine.
What is the SMILES notation for benzyl formate;1-methyl-2-methylsulfonylpyrrolidine?
The canonical SMILES for benzyl formate;1-methyl-2-methylsulfonylpyrrolidine is CN1CCCC1S(C)(=O)=O.O=COCc1ccccc1.
What is the InChIKey of benzyl formate;1-methyl-2-methylsulfonylpyrrolidine?
The InChIKey is XHAWUXQSDAOTHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H13NO2S/c9-7-10-6-8-4-2-1-3-5-8;1-7-5-3-4-6(7)10(2,8)9/h1-5,7H,6H2;6H,3-5H2,1-2H3.
What are the key properties of benzyl formate;1-methyl-2-methylsulfonylpyrrolidine?
benzyl formate;1-methyl-2-methylsulfonylpyrrolidine has a molecular weight of 299.39 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl formate;1-methyl-2-methylsulfonylpyrrolidine is sourced from PubChem (CID 174511816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).