About benzyl formate;1-methylpyrrolidine;2-oxopropanal
benzyl formate;1-methylpyrrolidine;2-oxopropanal (PubChem CID 142105796) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is benzyl formate;1-methylpyrrolidine;2-oxopropanal.
Molecular Properties
| Compound Name | benzyl formate;1-methylpyrrolidine;2-oxopropanal |
| PubChem CID | 142105796 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | benzyl formate;1-methylpyrrolidine;2-oxopropanal |
| SMILES | CC(=O)C=O.CN1CCCC1.O=COCc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C5H11N.C3H4O2/c9-7-10-6-8-4-2-1-3-5-8;1-6-4-2-3-5-6;1-3(5)2-4/h1-5,7H,6H2;2-5H2,1H3;2H,1H3 |
| InChIKey | GGEFADJRKBLGBZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl formate;1-methylpyrrolidine;2-oxopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl formate;1-methylpyrrolidine;2-oxopropanal?
The IUPAC name of benzyl formate;1-methylpyrrolidine;2-oxopropanal (CID 142105796) is benzyl formate;1-methylpyrrolidine;2-oxopropanal.
What is the SMILES notation for benzyl formate;1-methylpyrrolidine;2-oxopropanal?
The canonical SMILES for benzyl formate;1-methylpyrrolidine;2-oxopropanal is CC(=O)C=O.CN1CCCC1.O=COCc1ccccc1.
What is the InChIKey of benzyl formate;1-methylpyrrolidine;2-oxopropanal?
The InChIKey is GGEFADJRKBLGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C5H11N.C3H4O2/c9-7-10-6-8-4-2-1-3-5-8;1-6-4-2-3-5-6;1-3(5)2-4/h1-5,7H,6H2;2-5H2,1H3;2H,1H3.
What are the key properties of benzyl formate;1-methylpyrrolidine;2-oxopropanal?
benzyl formate;1-methylpyrrolidine;2-oxopropanal has a molecular weight of 293.36 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl formate;1-methylpyrrolidine;2-oxopropanal is sourced from PubChem (CID 142105796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).