About benzyl formate;piperazine-1-carbothioamide
benzyl formate;piperazine-1-carbothioamide (PubChem CID 157433611) has the molecular formula C13H19N3O2S
and a molecular weight of 281.38 g/mol. Its IUPAC name is benzyl formate;piperazine-1-carbothioamide.
Molecular Properties
| Compound Name | benzyl formate;piperazine-1-carbothioamide |
| PubChem CID | 157433611 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | benzyl formate;piperazine-1-carbothioamide |
| SMILES | NC(=S)N1CCNCC1.O=COCc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C5H11N3S/c9-7-10-6-8-4-2-1-3-5-8;6-5(9)8-3-1-7-2-4-8/h1-5,7H,6H2;7H,1-4H2,(H2,6,9) |
| InChIKey | BQVIYQJCCKZHBK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl formate;piperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl formate;piperazine-1-carbothioamide?
The IUPAC name of benzyl formate;piperazine-1-carbothioamide (CID 157433611) is benzyl formate;piperazine-1-carbothioamide.
What is the SMILES notation for benzyl formate;piperazine-1-carbothioamide?
The canonical SMILES for benzyl formate;piperazine-1-carbothioamide is NC(=S)N1CCNCC1.O=COCc1ccccc1.
What is the InChIKey of benzyl formate;piperazine-1-carbothioamide?
The InChIKey is BQVIYQJCCKZHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C5H11N3S/c9-7-10-6-8-4-2-1-3-5-8;6-5(9)8-3-1-7-2-4-8/h1-5,7H,6H2;7H,1-4H2,(H2,6,9).
What are the key properties of benzyl formate;piperazine-1-carbothioamide?
benzyl formate;piperazine-1-carbothioamide has a molecular weight of 281.38 g/mol, XLogP of 0.49, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl formate;piperazine-1-carbothioamide is sourced from PubChem (CID 157433611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).