C12H17FN2O2 — CID 174927682
benzyl formate;(3R,4R)-4-fluoropyrrolidin-3-amine (PubChem CID 174927682) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is benzyl formate;(3R,4R)-4-fluoropyrrolidin-3-amine.
| Compound Name | benzyl formate;(3R,4R)-4-fluoropyrrolidin-3-amine |
|---|---|
| PubChem CID | 174927682 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | benzyl formate;(3R,4R)-4-fluoropyrrolidin-3-amine |
| SMILES | N[C@@H]1CNC[C@H]1F.O=COCc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C4H9FN2/c9-7-10-6-8-4-2-1-3-5-8;5-3-1-7-2-4(3)6/h1-5,7H,6H2;3-4,7H,1-2,6H2/t;3-,4-/m.1/s1 |
| InChIKey | JJOWWCBFIRTVPI-WKUSAUFCSA-N |
| XLogP | 0.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|