C22H28O2 — CID 174582130
benzyl formate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 174582130) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is benzyl formate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | benzyl formate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 174582130 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | benzyl formate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | C1C2CC3C4CC5CC(C14)C(C2)C3C5.O=COCc1ccccc1 |
| InChI | InChI=1S/C14H20.C8H8O2/c1-7-2-12-10-4-8-5-11(9(1)10)13(3-7)14(12)6-8;9-7-10-6-8-4-2-1-3-5-8/h7-14H,1-6H2;1-5,7H,6H2 |
| InChIKey | WHRTTZVGEQRJCS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|