About benzyl formate;2-phenyladamantane
benzyl formate;2-phenyladamantane (PubChem CID 162139148) has the molecular formula C24H28O2
and a molecular weight of 348.49 g/mol. Its IUPAC name is benzyl formate;2-phenyladamantane.
Molecular Properties
| Compound Name | benzyl formate;2-phenyladamantane |
| PubChem CID | 162139148 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | benzyl formate;2-phenyladamantane |
| SMILES | O=COCc1ccccc1.c1ccc(C2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C16H20.C8H8O2/c1-2-4-13(5-3-1)16-14-7-11-6-12(9-14)10-15(16)8-11;9-7-10-6-8-4-2-1-3-5-8/h1-5,11-12,14-16H,6-10H2;1-5,7H,6H2 |
| InChIKey | ZJRSXTHPOJONRF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzyl formate;2-phenyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl formate;2-phenyladamantane?
The IUPAC name of benzyl formate;2-phenyladamantane (CID 162139148) is benzyl formate;2-phenyladamantane.
What is the SMILES notation for benzyl formate;2-phenyladamantane?
The canonical SMILES for benzyl formate;2-phenyladamantane is O=COCc1ccccc1.c1ccc(C2C3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of benzyl formate;2-phenyladamantane?
The InChIKey is ZJRSXTHPOJONRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20.C8H8O2/c1-2-4-13(5-3-1)16-14-7-11-6-12(9-14)10-15(16)8-11;9-7-10-6-8-4-2-1-3-5-8/h1-5,11-12,14-16H,6-10H2;1-5,7H,6H2.
What are the key properties of benzyl formate;2-phenyladamantane?
benzyl formate;2-phenyladamantane has a molecular weight of 348.49 g/mol, XLogP of 5.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl formate;2-phenyladamantane is sourced from PubChem (CID 162139148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).