C14H16FNO3 — CID 161079088
benzyl formate;(3S,4S)-4-ethenyl-3-fluoropyrrolidin-2-one (PubChem CID 161079088) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is benzyl formate;(3S,4S)-4-ethenyl-3-fluoropyrrolidin-2-one.
| Compound Name | benzyl formate;(3S,4S)-4-ethenyl-3-fluoropyrrolidin-2-one |
|---|---|
| PubChem CID | 161079088 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | benzyl formate;(3S,4S)-4-ethenyl-3-fluoropyrrolidin-2-one |
| SMILES | C=C[C@H]1CNC(=O)[C@H]1F.O=COCc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C6H8FNO/c9-7-10-6-8-4-2-1-3-5-8;1-2-4-3-8-6(9)5(4)7/h1-5,7H,6H2;2,4-5H,1,3H2,(H,8,9)/t;4-,5-/m.0/s1 |
| InChIKey | UFRCPMDSERFUHC-CKDWGAALSA-N |
| XLogP | 1.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|