C23H37N3O6 — CID 174724044
benzyl formate;tert-butyl N-[(3S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate (PubChem CID 174724044) has the molecular formula C23H37N3O6 and a molecular weight of 451.56 g/mol. Its IUPAC name is benzyl formate;tert-butyl N-[(3S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate.
| Compound Name | benzyl formate;tert-butyl N-[(3S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 174724044 |
| Molecular Formula | C23H37N3O6 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | benzyl formate;tert-butyl N-[(3S,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@H](NC(=O)OC(C)(C)C)C1.O=COCc1ccccc1 |
| InChI | InChI=1S/C15H29N3O4.C8H8O2/c1-14(2,3)21-12(19)17-10-7-11(9-16-8-10)18-13(20)22-15(4,5)6;9-7-10-6-8-4-2-1-3-5-8/h10-11,16H,7-9H2,1-6H3,(H,17,19)(H,18,20);1-5,7H,6H2/t10-,11+; |
| InChIKey | XXBOAPZFQRGYBR-NJJJQDLFSA-N |
| XLogP | 3.13 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|