C17H26N2O5 — CID 158392028
benzyl formate;tert-butyl N-(4-hydroxypyrrolidin-3-yl)carbamate (PubChem CID 158392028) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is benzyl formate;tert-butyl N-(4-hydroxypyrrolidin-3-yl)carbamate.
| Compound Name | benzyl formate;tert-butyl N-(4-hydroxypyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 158392028 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | benzyl formate;tert-butyl N-(4-hydroxypyrrolidin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CNCC1O.O=COCc1ccccc1 |
| InChI | InChI=1S/C9H18N2O3.C8H8O2/c1-9(2,3)14-8(13)11-6-4-10-5-7(6)12;9-7-10-6-8-4-2-1-3-5-8/h6-7,10,12H,4-5H2,1-3H3,(H,11,13);1-5,7H,6H2 |
| InChIKey | GXBPNRLHVCTMTM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|