C25H35N3O4 — CID 174927688
benzyl formate;tert-butyl N-[2-(4-piperazin-1-ylphenyl)ethyl]carbamate (PubChem CID 174927688) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is benzyl formate;tert-butyl N-[2-(4-piperazin-1-ylphenyl)ethyl]carbamate.
| Compound Name | benzyl formate;tert-butyl N-[2-(4-piperazin-1-ylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 174927688 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | benzyl formate;tert-butyl N-[2-(4-piperazin-1-ylphenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(N2CCNCC2)cc1.O=COCc1ccccc1 |
| InChI | InChI=1S/C17H27N3O2.C8H8O2/c1-17(2,3)22-16(21)19-9-8-14-4-6-15(7-5-14)20-12-10-18-11-13-20;9-7-10-6-8-4-2-1-3-5-8/h4-7,18H,8-13H2,1-3H3,(H,19,21);1-5,7H,6H2 |
| InChIKey | PXZRICQZRXYQME-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|