C16H22BrNO3 — CID 175158622
benzyl formate;2-bromo-1-[(3R,4S)-4-ethylpyrrolidin-3-yl]ethanone (PubChem CID 175158622) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is benzyl formate;2-bromo-1-[(3R,4S)-4-ethylpyrrolidin-3-yl]ethanone.
| Compound Name | benzyl formate;2-bromo-1-[(3R,4S)-4-ethylpyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 175158622 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | benzyl formate;2-bromo-1-[(3R,4S)-4-ethylpyrrolidin-3-yl]ethanone |
| SMILES | CC[C@@H]1CNC[C@@H]1C(=O)CBr.O=COCc1ccccc1 |
| InChI | InChI=1S/C8H14BrNO.C8H8O2/c1-2-6-4-10-5-7(6)8(11)3-9;9-7-10-6-8-4-2-1-3-5-8/h6-7,10H,2-5H2,1H3;1-5,7H,6H2/t6-,7+;/m1./s1 |
| InChIKey | NGJAVDZYODDOIB-HHQFNNIRSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|