C16H28N2O3S — CID 173258331
N-benzyl-N-methylethanamine;cyclohexylsulfamic acid (PubChem CID 173258331) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is N-benzyl-N-methylethanamine;cyclohexylsulfamic acid.
| Compound Name | N-benzyl-N-methylethanamine;cyclohexylsulfamic acid |
|---|---|
| PubChem CID | 173258331 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-benzyl-N-methylethanamine;cyclohexylsulfamic acid |
| SMILES | CCN(C)Cc1ccccc1.O=S(=O)(O)NC1CCCCC1 |
| InChI | InChI=1S/C10H15N.C6H13NO3S/c1-3-11(2)9-10-7-5-4-6-8-10;8-11(9,10)7-6-4-2-1-3-5-6/h4-8H,3,9H2,1-2H3;6-7H,1-5H2,(H,8,9,10) |
| InChIKey | OYZXMJJRABIKFO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|