C10H14Cl2O3 — CID 101411815
tert-butyl (1S,2S,5S)-2,5-dichloro-6-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 101411815) has the molecular formula C10H14Cl2O3 and a molecular weight of 253.12 g/mol. Its IUPAC name is tert-butyl (1S,2S,5S)-2,5-dichloro-6-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | tert-butyl (1S,2S,5S)-2,5-dichloro-6-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 101411815 |
| Molecular Formula | C10H14Cl2O3 |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | tert-butyl (1S,2S,5S)-2,5-dichloro-6-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]12O[C@]1(Cl)CC[C@@H]2Cl |
| InChI | InChI=1S/C10H14Cl2O3/c1-8(2,3)14-7(13)10-6(11)4-5-9(10,12)15-10/h6H,4-5H2,1-3H3/t6-,9+,10+/m0/s1 |
| InChIKey | ZDKMZCPMBCLWHK-WQGWLQIFSA-N |
| XLogP | 2.43 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|