C25H40O12 — CID 11800397
tritert-butyl (1S,4S,6R,7R,8R,9S,10S)-7,9-dihydroxy-4-methoxy-5,11,12-trioxatricyclo[6.3.1.01,6]dodecane-8,9,10-tricarboxylate (PubChem CID 11800397) has the molecular formula C25H40O12 and a molecular weight of 532.58 g/mol. Its IUPAC name is tritert-butyl (1S,4S,6R,7R,8R,9S,10S)-7,9-dihydroxy-4-methoxy-5,11,12-trioxatricyclo[6.3.1.01,6]dodecane-8,9,10-tricarboxylate.
| Compound Name | tritert-butyl (1S,4S,6R,7R,8R,9S,10S)-7,9-dihydroxy-4-methoxy-5,11,12-trioxatricyclo[6.3.1.01,6]dodecane-8,9,10-tricarboxylate |
|---|---|
| PubChem CID | 11800397 |
| Molecular Formula | C25H40O12 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | tritert-butyl (1S,4S,6R,7R,8R,9S,10S)-7,9-dihydroxy-4-methoxy-5,11,12-trioxatricyclo[6.3.1.01,6]dodecane-8,9,10-tricarboxylate |
| SMILES | CO[C@@H]1CC[C@]23O[C@H](C(=O)OC(C)(C)C)[C@@](O)(C(=O)OC(C)(C)C)[C@](C(=O)OC(C)(C)C)(O2)[C@H](O)[C@H]3O1 |
| InChI | InChI=1S/C25H40O12/c1-20(2,3)34-17(27)16-24(30,18(28)35-21(4,5)6)25(19(29)36-22(7,8)9)14(26)15-23(33-16,37-25)12-11-13(31-10)32-15/h13-16,26,30H,11-12H2,1-10H3/t13-,14+,15+,16+,23-,24+,25-/m0/s1 |
| InChIKey | DCTTZFLTQNDCKS-ZWUIKGMRSA-N |
| XLogP | 1.12 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|