C13H24O3 — CID 174406188
tert-butyl 3-(2,2-dimethylpropyl)-3-methyloxirane-2-carboxylate (PubChem CID 174406188) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is tert-butyl 3-(2,2-dimethylpropyl)-3-methyloxirane-2-carboxylate.
| Compound Name | tert-butyl 3-(2,2-dimethylpropyl)-3-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 174406188 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | tert-butyl 3-(2,2-dimethylpropyl)-3-methyloxirane-2-carboxylate |
| SMILES | CC(C)(C)CC1(C)OC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24O3/c1-11(2,3)8-13(7)9(15-13)10(14)16-12(4,5)6/h9H,8H2,1-7H3 |
| InChIKey | VZBIYWWEOJGYQQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|