C13H24O3 — CID 559057
tert-butyl 3-(3,3-dimethyloxiran-2-yl)-2,2-dimethylpropanoate (PubChem CID 559057) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is tert-butyl 3-(3,3-dimethyloxiran-2-yl)-2,2-dimethylpropanoate.
| Compound Name | tert-butyl 3-(3,3-dimethyloxiran-2-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 559057 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | tert-butyl 3-(3,3-dimethyloxiran-2-yl)-2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)CC1OC1(C)C |
| InChI | InChI=1S/C13H24O3/c1-11(2,3)16-10(14)12(4,5)8-9-13(6,7)15-9/h9H,8H2,1-7H3 |
| InChIKey | LYVXKEZPVNJBPN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|