C10H20O5S — CID 121471937
tert-butyl 2,2-dimethyl-3-methylsulfonyloxypropanoate (PubChem CID 121471937) has the molecular formula C10H20O5S and a molecular weight of 252.33 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-3-methylsulfonyloxypropanoate.
| Compound Name | tert-butyl 2,2-dimethyl-3-methylsulfonyloxypropanoate |
|---|---|
| PubChem CID | 121471937 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | tert-butyl 2,2-dimethyl-3-methylsulfonyloxypropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)COS(C)(=O)=O |
| InChI | InChI=1S/C10H20O5S/c1-9(2,3)15-8(11)10(4,5)7-14-16(6,12)13/h7H2,1-6H3 |
| InChIKey | FYAPOCVLYSKSBH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|