C7H15NO6S — CID 11253497
[(2S)-2-hydroxy-3-[methoxy(methyl)amino]-2-methyl-3-oxopropyl] methanesulfonate (PubChem CID 11253497) has the molecular formula C7H15NO6S and a molecular weight of 241.26 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[methoxy(methyl)amino]-2-methyl-3-oxopropyl] methanesulfonate.
| Compound Name | [(2S)-2-hydroxy-3-[methoxy(methyl)amino]-2-methyl-3-oxopropyl] methanesulfonate |
|---|---|
| PubChem CID | 11253497 |
| Molecular Formula | C7H15NO6S |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | [(2S)-2-hydroxy-3-[methoxy(methyl)amino]-2-methyl-3-oxopropyl] methanesulfonate |
| SMILES | CON(C)C(=O)[C@@](C)(O)COS(C)(=O)=O |
| InChI | InChI=1S/C7H15NO6S/c1-7(10,5-14-15(4,11)12)6(9)8(2)13-3/h10H,5H2,1-4H3/t7-/m0/s1 |
| InChIKey | HXTQBSSFUMONKW-ZETCQYMHSA-N |
| XLogP | -1.27 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|