C7H16O5S — CID 168838894
(3-hydroxy-3-methoxy-2,2-dimethylpropyl) methanesulfonate (PubChem CID 168838894) has the molecular formula C7H16O5S and a molecular weight of 212.27 g/mol. Its IUPAC name is (3-hydroxy-3-methoxy-2,2-dimethylpropyl) methanesulfonate.
| Compound Name | (3-hydroxy-3-methoxy-2,2-dimethylpropyl) methanesulfonate |
|---|---|
| PubChem CID | 168838894 |
| Molecular Formula | C7H16O5S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (3-hydroxy-3-methoxy-2,2-dimethylpropyl) methanesulfonate |
| SMILES | COC(O)C(C)(C)COS(C)(=O)=O |
| InChI | InChI=1S/C7H16O5S/c1-7(2,6(8)11-3)5-12-13(4,9)10/h6,8H,5H2,1-4H3 |
| InChIKey | NDKKKQKLLSXCAL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|