C8H18O6S2 — CID 124927583
[(3S)-2,2-dimethyl-3-methylsulfonyloxybutyl] methanesulfonate (PubChem CID 124927583) has the molecular formula C8H18O6S2 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(3S)-2,2-dimethyl-3-methylsulfonyloxybutyl] methanesulfonate.
| Compound Name | [(3S)-2,2-dimethyl-3-methylsulfonyloxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 124927583 |
| Molecular Formula | C8H18O6S2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [(3S)-2,2-dimethyl-3-methylsulfonyloxybutyl] methanesulfonate |
| SMILES | C[C@H](OS(C)(=O)=O)C(C)(C)COS(C)(=O)=O |
| InChI | InChI=1S/C8H18O6S2/c1-7(14-16(5,11)12)8(2,3)6-13-15(4,9)10/h7H,6H2,1-5H3/t7-/m0/s1 |
| InChIKey | RKUCOAXJFMLYFB-ZETCQYMHSA-N |
| XLogP | 0.35 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|