About 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate
2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate (PubChem CID 59271065) has the molecular formula C13H28O6S
and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate |
| PubChem CID | 59271065 |
| Molecular Formula | C13H28O6S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate |
| SMILES | CC(COCCOCC(C)(C)C)OCCOS(C)(=O)=O |
| InChI | InChI=1S/C13H28O6S/c1-12(18-8-9-19-20(5,14)15)10-16-6-7-17-11-13(2,3)4/h12H,6-11H2,1-5H3 |
| InChIKey | BLBYUIJQBBNDHX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate?
The IUPAC name of 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate (CID 59271065) is 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate.
What is the SMILES notation for 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate?
The canonical SMILES for 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate is CC(COCCOCC(C)(C)C)OCCOS(C)(=O)=O.
What is the InChIKey of 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate?
The InChIKey is BLBYUIJQBBNDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O6S/c1-12(18-8-9-19-20(5,14)15)10-16-6-7-17-11-13(2,3)4/h12H,6-11H2,1-5H3.
What are the key properties of 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate?
2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate has a molecular weight of 312.43 g/mol, XLogP of 1.45, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate is sourced from PubChem (CID 59271065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).