C13H28O6S — CID 59271065
2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate (PubChem CID 59271065) has the molecular formula C13H28O6S and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate.
| Compound Name | 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 59271065 |
| Molecular Formula | C13H28O6S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[1-[2-(2,2-dimethylpropoxy)ethoxy]propan-2-yloxy]ethyl methanesulfonate |
| SMILES | CC(COCCOCC(C)(C)C)OCCOS(C)(=O)=O |
| InChI | InChI=1S/C13H28O6S/c1-12(18-8-9-19-20(5,14)15)10-16-6-7-17-11-13(2,3)4/h12H,6-11H2,1-5H3 |
| InChIKey | BLBYUIJQBBNDHX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|