C10H16O4S2 — CID 10858352
(3-hydroxy-2,2-dimethyl-3-thiophen-2-ylpropyl) methanesulfonate (PubChem CID 10858352) has the molecular formula C10H16O4S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethyl-3-thiophen-2-ylpropyl) methanesulfonate.
| Compound Name | (3-hydroxy-2,2-dimethyl-3-thiophen-2-ylpropyl) methanesulfonate |
|---|---|
| PubChem CID | 10858352 |
| Molecular Formula | C10H16O4S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (3-hydroxy-2,2-dimethyl-3-thiophen-2-ylpropyl) methanesulfonate |
| SMILES | CC(C)(COS(C)(=O)=O)C(O)c1cccs1 |
| InChI | InChI=1S/C10H16O4S2/c1-10(2,7-14-16(3,12)13)9(11)8-5-4-6-15-8/h4-6,9,11H,7H2,1-3H3 |
| InChIKey | IQYOZDZJOLFHCS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|